C12H8F3N3O5 — CID 89388098
[2-(5-carbamimidoyl-2-oxo-1,3-benzoxazol-3-yl)acetyl] 2,2,2-trifluoroacetate (PubChem CID 89388098) has the molecular formula C12H8F3N3O5 and a molecular weight of 331.21 g/mol. Its IUPAC name is [2-(5-carbamimidoyl-2-oxo-1,3-benzoxazol-3-yl)acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-(5-carbamimidoyl-2-oxo-1,3-benzoxazol-3-yl)acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89388098 |
| Molecular Formula | C12H8F3N3O5 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [2-(5-carbamimidoyl-2-oxo-1,3-benzoxazol-3-yl)acetyl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc2oc(=O)n(CC(=O)OC(=O)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C12H8F3N3O5/c13-12(14,15)10(20)23-8(19)4-18-6-3-5(9(16)17)1-2-7(6)22-11(18)21/h1-3H,4H2,(H3,16,17) |
| InChIKey | XOBXBCWWDAYWPZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|