C9H5Cl2NO3 — CID 12547768
2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetyl chloride (PubChem CID 12547768) has the molecular formula C9H5Cl2NO3 and a molecular weight of 246.05 g/mol. Its IUPAC name is 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetyl chloride.
| Compound Name | 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetyl chloride |
|---|---|
| PubChem CID | 12547768 |
| Molecular Formula | C9H5Cl2NO3 |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 244.96 |
| IUPAC Name | 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetyl chloride |
| SMILES | O=C(Cl)Cn1c(=O)oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H5Cl2NO3/c10-5-1-2-7-6(3-5)12(4-8(11)13)9(14)15-7/h1-3H,4H2 |
| InChIKey | HRYYZNWFWVMALX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|