C10H7BrClNO3 — CID 12577340
3-(3-bromo-2-oxopropyl)-5-chloro-1,3-benzoxazol-2-one (PubChem CID 12577340) has the molecular formula C10H7BrClNO3 and a molecular weight of 304.53 g/mol. Its IUPAC name is 3-(3-bromo-2-oxopropyl)-5-chloro-1,3-benzoxazol-2-one.
| Compound Name | 3-(3-bromo-2-oxopropyl)-5-chloro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 12577340 |
| Molecular Formula | C10H7BrClNO3 |
| Molecular Weight | 304.53 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 3-(3-bromo-2-oxopropyl)-5-chloro-1,3-benzoxazol-2-one |
| SMILES | O=C(CBr)Cn1c(=O)oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H7BrClNO3/c11-4-7(14)5-13-8-3-6(12)1-2-9(8)16-10(13)15/h1-3H,4-5H2 |
| InChIKey | IKTXCMYQTXSDIT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|