C29H23F3N2O4 — CID 67992425
ethyl 2-[5-[(E)-2-[1-oxo-2-[4-(trifluoromethoxy)phenyl]-3H-isoindol-4-yl]ethenyl]indol-1-yl]acetate (PubChem CID 67992425) has the molecular formula C29H23F3N2O4 and a molecular weight of 520.51 g/mol. Its IUPAC name is ethyl 2-[5-[(E)-2-[1-oxo-2-[4-(trifluoromethoxy)phenyl]-3H-isoindol-4-yl]ethenyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[5-[(E)-2-[1-oxo-2-[4-(trifluoromethoxy)phenyl]-3H-isoindol-4-yl]ethenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 67992425 |
| Molecular Formula | C29H23F3N2O4 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | ethyl 2-[5-[(E)-2-[1-oxo-2-[4-(trifluoromethoxy)phenyl]-3H-isoindol-4-yl]ethenyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ccc2cc(/C=C/c3cccc4c3CN(c3ccc(OC(F)(F)F)cc3)C4=O)ccc21 |
| InChI | InChI=1S/C29H23F3N2O4/c1-2-37-27(35)18-33-15-14-21-16-19(7-13-26(21)33)6-8-20-4-3-5-24-25(20)17-34(28(24)36)22-9-11-23(12-10-22)38-29(30,31)32/h3-16H,2,17-18H2,1H3/b8-6+ |
| InChIKey | PPPBUMJJZKAKPZ-SOFGYWHQSA-N |
| XLogP | 6.43 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|