C31H30F3NO6 — CID 67992437
ethyl 2-[5-[3-[[1-oxo-2-[4-(trifluoromethoxy)phenyl]-3H-isoindol-4-yl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetate (PubChem CID 67992437) has the molecular formula C31H30F3NO6 and a molecular weight of 569.58 g/mol. Its IUPAC name is ethyl 2-[5-[3-[[1-oxo-2-[4-(trifluoromethoxy)phenyl]-3H-isoindol-4-yl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetate.
| Compound Name | ethyl 2-[5-[3-[[1-oxo-2-[4-(trifluoromethoxy)phenyl]-3H-isoindol-4-yl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetate |
|---|---|
| PubChem CID | 67992437 |
| Molecular Formula | C31H30F3NO6 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | ethyl 2-[5-[3-[[1-oxo-2-[4-(trifluoromethoxy)phenyl]-3H-isoindol-4-yl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetate |
| SMILES | CCOC(=O)CC1CCc2cc(OCCCOc3cccc4c3CN(c3ccc(OC(F)(F)F)cc3)C4=O)ccc21 |
| InChI | InChI=1S/C31H30F3NO6/c1-2-38-29(36)18-21-8-7-20-17-24(13-14-25(20)21)39-15-4-16-40-28-6-3-5-26-27(28)19-35(30(26)37)22-9-11-23(12-10-22)41-31(32,33)34/h3,5-6,9-14,17,21H,2,4,7-8,15-16,18-19H2,1H3 |
| InChIKey | LUCOBYMUSIXJSP-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|