C23H27BrO5 — CID 59300414
ethyl 2-[(1S)-5-[3-(4-bromo-2-methoxyphenoxy)propoxy]-2,3-dihydro-1H-inden-1-yl]acetate (PubChem CID 59300414) has the molecular formula C23H27BrO5 and a molecular weight of 463.37 g/mol. Its IUPAC name is ethyl 2-[(1S)-5-[3-(4-bromo-2-methoxyphenoxy)propoxy]-2,3-dihydro-1H-inden-1-yl]acetate.
| Compound Name | ethyl 2-[(1S)-5-[3-(4-bromo-2-methoxyphenoxy)propoxy]-2,3-dihydro-1H-inden-1-yl]acetate |
|---|---|
| PubChem CID | 59300414 |
| Molecular Formula | C23H27BrO5 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | ethyl 2-[(1S)-5-[3-(4-bromo-2-methoxyphenoxy)propoxy]-2,3-dihydro-1H-inden-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CCc2cc(OCCCOc3ccc(Br)cc3OC)ccc21 |
| InChI | InChI=1S/C23H27BrO5/c1-3-27-23(25)14-17-6-5-16-13-19(8-9-20(16)17)28-11-4-12-29-21-10-7-18(24)15-22(21)26-2/h7-10,13,15,17H,3-6,11-12,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | AFNWAIAAHZFZIP-KRWDZBQOSA-N |
| XLogP | 5.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|