C32H38O4 — CID 58990560
ethyl 2-[6-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate (PubChem CID 58990560) has the molecular formula C32H38O4 and a molecular weight of 486.65 g/mol. Its IUPAC name is ethyl 2-[6-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate.
| Compound Name | ethyl 2-[6-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 58990560 |
| Molecular Formula | C32H38O4 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | ethyl 2-[6-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate |
| SMILES | CCCCOc1ccc(C)cc1-c1ccc(COc2ccc3c(c2)CCCC3CC(=O)OCC)cc1 |
| InChI | InChI=1S/C32H38O4/c1-4-6-18-35-31-17-10-23(3)19-30(31)25-13-11-24(12-14-25)22-36-28-15-16-29-26(20-28)8-7-9-27(29)21-32(33)34-5-2/h10-17,19-20,27H,4-9,18,21-22H2,1-3H3 |
| InChIKey | AWTZNRRCAMELSL-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|