C29H29NO5 — CID 67992498
2-[5-[3-[[2-(4-methylphenyl)-1-oxo-3H-isoindol-4-yl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 67992498) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is 2-[5-[3-[[2-(4-methylphenyl)-1-oxo-3H-isoindol-4-yl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[5-[3-[[2-(4-methylphenyl)-1-oxo-3H-isoindol-4-yl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 67992498 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-[5-[3-[[2-(4-methylphenyl)-1-oxo-3H-isoindol-4-yl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | Cc1ccc(N2Cc3c(OCCCOc4ccc5c(c4)CCC5CC(=O)O)cccc3C2=O)cc1 |
| InChI | InChI=1S/C29H29NO5/c1-19-6-10-22(11-7-19)30-18-26-25(29(30)33)4-2-5-27(26)35-15-3-14-34-23-12-13-24-20(16-23)8-9-21(24)17-28(31)32/h2,4-7,10-13,16,21H,3,8-9,14-15,17-18H2,1H3,(H,31,32) |
| InChIKey | RUQBXRHBVFLCPV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|