C14H11F5O3 — CID 170472232
ethyl 4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]but-3-ynoate (PubChem CID 170472232) has the molecular formula C14H11F5O3 and a molecular weight of 322.23 g/mol. Its IUPAC name is ethyl 4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]but-3-ynoate.
| Compound Name | ethyl 4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]but-3-ynoate |
|---|---|
| PubChem CID | 170472232 |
| Molecular Formula | C14H11F5O3 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | ethyl 4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]but-3-ynoate |
| SMILES | CCOC(=O)CC#Cc1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F5O3/c1-2-21-12(20)5-3-4-10-6-8-11(9-7-10)22-14(18,19)13(15,16)17/h6-9H,2,5H2,1H3 |
| InChIKey | SUSUCHAVEFILGT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|