C26H27F3O5 — CID 69457871
2-[4-[1-cyclobutyl-4-[4-(trifluoromethoxy)phenyl]but-3-ynoxy]-2-methylphenoxy]-2-methylpropanoic acid (PubChem CID 69457871) has the molecular formula C26H27F3O5 and a molecular weight of 476.49 g/mol. Its IUPAC name is 2-[4-[1-cyclobutyl-4-[4-(trifluoromethoxy)phenyl]but-3-ynoxy]-2-methylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[1-cyclobutyl-4-[4-(trifluoromethoxy)phenyl]but-3-ynoxy]-2-methylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 69457871 |
| Molecular Formula | C26H27F3O5 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-[4-[1-cyclobutyl-4-[4-(trifluoromethoxy)phenyl]but-3-ynoxy]-2-methylphenoxy]-2-methylpropanoic acid |
| SMILES | Cc1cc(OC(CC#Cc2ccc(OC(F)(F)F)cc2)C2CCC2)ccc1OC(C)(C)C(=O)O |
| InChI | InChI=1S/C26H27F3O5/c1-17-16-21(14-15-22(17)34-25(2,3)24(30)31)32-23(19-7-5-8-19)9-4-6-18-10-12-20(13-11-18)33-26(27,28)29/h10-16,19,23H,5,7-9H2,1-3H3,(H,30,31) |
| InChIKey | VTDHPQFTNDTYGH-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|