C9H7F3N2O3S — CID 11507419
2-methylsulfonyl-6-(trifluoromethoxy)-1H-benzimidazole (PubChem CID 11507419) has the molecular formula C9H7F3N2O3S and a molecular weight of 280.23 g/mol. Its IUPAC name is 2-methylsulfonyl-6-(trifluoromethoxy)-1H-benzimidazole.
| Compound Name | 2-methylsulfonyl-6-(trifluoromethoxy)-1H-benzimidazole |
|---|---|
| PubChem CID | 11507419 |
| Molecular Formula | C9H7F3N2O3S |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 2-methylsulfonyl-6-(trifluoromethoxy)-1H-benzimidazole |
| SMILES | CS(=O)(=O)c1nc2ccc(OC(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C9H7F3N2O3S/c1-18(15,16)8-13-6-3-2-5(4-7(6)14-8)17-9(10,11)12/h2-4H,1H3,(H,13,14) |
| InChIKey | KLVPHYXSUSITMJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |