C12H17N3O4S2 — CID 123698941
N-butyl-2-methylsulfonyl-3H-benzimidazole-5-sulfonamide (PubChem CID 123698941) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-butyl-2-methylsulfonyl-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-butyl-2-methylsulfonyl-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 123698941 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-butyl-2-methylsulfonyl-3H-benzimidazole-5-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2nc(S(C)(=O)=O)[nH]c2c1 |
| InChI | InChI=1S/C12H17N3O4S2/c1-3-4-7-13-21(18,19)9-5-6-10-11(8-9)15-12(14-10)20(2,16)17/h5-6,8,13H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | HLFIBXJFFDKWCQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|