C18H19N5O3S3 — CID 2088087
N-butyl-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-3H-benzimidazole-5-sulfonamide (PubChem CID 2088087) has the molecular formula C18H19N5O3S3 and a molecular weight of 449.58 g/mol. Its IUPAC name is N-butyl-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-butyl-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 2088087 |
| Molecular Formula | C18H19N5O3S3 |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | N-butyl-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-3H-benzimidazole-5-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2nc(SCc3cc(=O)n4ccsc4n3)[nH]c2c1 |
| InChI | InChI=1S/C18H19N5O3S3/c1-2-3-6-19-29(25,26)13-4-5-14-15(10-13)22-17(21-14)28-11-12-9-16(24)23-7-8-27-18(23)20-12/h4-5,7-10,19H,2-3,6,11H2,1H3,(H,21,22) |
| InChIKey | WQCRDDXEGMESJT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|