C10H12N2O3S3 — CID 47359347
7-(2-methylsulfonylethylsulfanylmethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 47359347) has the molecular formula C10H12N2O3S3 and a molecular weight of 304.42 g/mol. Its IUPAC name is 7-(2-methylsulfonylethylsulfanylmethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-(2-methylsulfonylethylsulfanylmethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 47359347 |
| Molecular Formula | C10H12N2O3S3 |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 7-(2-methylsulfonylethylsulfanylmethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CS(=O)(=O)CCSCc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C10H12N2O3S3/c1-18(14,15)5-4-16-7-8-6-9(13)12-2-3-17-10(12)11-8/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | GQODEFXFDNSXCN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|