C11H15N3OS2 — CID 66232840
7-(3-aminobutylsulfanylmethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 66232840) has the molecular formula C11H15N3OS2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 7-(3-aminobutylsulfanylmethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-(3-aminobutylsulfanylmethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 66232840 |
| Molecular Formula | C11H15N3OS2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 7-(3-aminobutylsulfanylmethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CC(N)CCSCc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C11H15N3OS2/c1-8(12)2-4-16-7-9-6-10(15)14-3-5-17-11(14)13-9/h3,5-6,8H,2,4,7,12H2,1H3 |
| InChIKey | AWOJCZDWJXVPGF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|