C21H23N5O3S2 — CID 2108766
N-butyl-2-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-3H-benzimidazole-5-sulfonamide (PubChem CID 2108766) has the molecular formula C21H23N5O3S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-butyl-2-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-butyl-2-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 2108766 |
| Molecular Formula | C21H23N5O3S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-butyl-2-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-3H-benzimidazole-5-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2nc(SCc3cc(=O)n4cc(C)ccc4n3)[nH]c2c1 |
| InChI | InChI=1S/C21H23N5O3S2/c1-3-4-9-22-31(28,29)16-6-7-17-18(11-16)25-21(24-17)30-13-15-10-20(27)26-12-14(2)5-8-19(26)23-15/h5-8,10-12,22H,3-4,9,13H2,1-2H3,(H,24,25) |
| InChIKey | QPRBJAKJNRYYIG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|