C21H24N4O3S2 — CID 2461509
N-butyl-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3H-benzimidazole-5-sulfonamide (PubChem CID 2461509) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-butyl-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-butyl-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 2461509 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-butyl-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3H-benzimidazole-5-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2nc(SCC(=O)N3CCc4ccccc43)[nH]c2c1 |
| InChI | InChI=1S/C21H24N4O3S2/c1-2-3-11-22-30(27,28)16-8-9-17-18(13-16)24-21(23-17)29-14-20(26)25-12-10-15-6-4-5-7-19(15)25/h4-9,13,22H,2-3,10-12,14H2,1H3,(H,23,24) |
| InChIKey | NRWBBNLQCPCRCB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|