C13H20N4O2S — CID 110760105
N-[3-(dimethylamino)propyl]-2-methyl-3H-benzimidazole-5-sulfonamide (PubChem CID 110760105) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-methyl-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-methyl-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760105 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-methyl-3H-benzimidazole-5-sulfonamide |
| SMILES | Cc1nc2ccc(S(=O)(=O)NCCCN(C)C)cc2[nH]1 |
| InChI | InChI=1S/C13H20N4O2S/c1-10-15-12-6-5-11(9-13(12)16-10)20(18,19)14-7-4-8-17(2)3/h5-6,9,14H,4,7-8H2,1-3H3,(H,15,16) |
| InChIKey | ZHOFUIJLUSCXRO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|