C10H12N2O3S — CID 116852802
2-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]ethanol (PubChem CID 116852802) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]ethanol.
| Compound Name | 2-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]ethanol |
|---|---|
| PubChem CID | 116852802 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]ethanol |
| SMILES | Cc1nc2ccc(S(=O)(=O)CCO)cc2[nH]1 |
| InChI | InChI=1S/C10H12N2O3S/c1-7-11-9-3-2-8(6-10(9)12-7)16(14,15)5-4-13/h2-3,6,13H,4-5H2,1H3,(H,11,12) |
| InChIKey | QOBVDBMSUVZFAS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |