C18H26N4O4S — CID 86595874
6-(2-hydroxyethylsulfonyl)-N-(1-propan-2-ylpiperidin-4-yl)-1H-benzimidazole-2-carboxamide (PubChem CID 86595874) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is 6-(2-hydroxyethylsulfonyl)-N-(1-propan-2-ylpiperidin-4-yl)-1H-benzimidazole-2-carboxamide.
| Compound Name | 6-(2-hydroxyethylsulfonyl)-N-(1-propan-2-ylpiperidin-4-yl)-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 86595874 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 6-(2-hydroxyethylsulfonyl)-N-(1-propan-2-ylpiperidin-4-yl)-1H-benzimidazole-2-carboxamide |
| SMILES | CC(C)N1CCC(NC(=O)c2nc3ccc(S(=O)(=O)CCO)cc3[nH]2)CC1 |
| InChI | InChI=1S/C18H26N4O4S/c1-12(2)22-7-5-13(6-8-22)19-18(24)17-20-15-4-3-14(11-16(15)21-17)27(25,26)10-9-23/h3-4,11-13,23H,5-10H2,1-2H3,(H,19,24)(H,20,21) |
| InChIKey | MICHLZAFHNBDMX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |