C38H56N8O6 — CID 162143796
4-(2-methoxyethoxy)-N-(1-propan-2-ylpiperidin-4-yl)-1H-benzimidazole-2-carboxamide (PubChem CID 162143796) has the molecular formula C38H56N8O6 and a molecular weight of 720.92 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N-(1-propan-2-ylpiperidin-4-yl)-1H-benzimidazole-2-carboxamide.
| Compound Name | 4-(2-methoxyethoxy)-N-(1-propan-2-ylpiperidin-4-yl)-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 162143796 |
| Molecular Formula | C38H56N8O6 |
| Molecular Weight | 720.92 g/mol |
| Exact Mass | 720.43 |
| IUPAC Name | 4-(2-methoxyethoxy)-N-(1-propan-2-ylpiperidin-4-yl)-1H-benzimidazole-2-carboxamide |
| SMILES | COCCOc1cccc2[nH]c(C(=O)NC3CCN(C(C)C)CC3)nc12.COCCOc1cccc2[nH]c(C(=O)NC3CCN(C(C)C)CC3)nc12 |
| InChI | InChI=1S/2C19H28N4O3/c2*1-13(2)23-9-7-14(8-10-23)20-19(24)18-21-15-5-4-6-16(17(15)22-18)26-12-11-25-3/h2*4-6,13-14H,7-12H2,1-3H3,(H,20,24)(H,21,22) |
| InChIKey | ZKGYNVXSUHVYHQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 158.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|