C11H14N2O3S — CID 110759607
N-butyl-1,3-benzoxazole-6-sulfonamide (PubChem CID 110759607) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-butyl-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-butyl-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 110759607 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-butyl-1,3-benzoxazole-6-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H14N2O3S/c1-2-3-6-13-17(14,15)9-4-5-10-11(7-9)16-8-12-10/h4-5,7-8,13H,2-3,6H2,1H3 |
| InChIKey | FIDGODBGCQRZRP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|