C11H14N2O4S — CID 110760630
N-butyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide (PubChem CID 110760630) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is N-butyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide.
| Compound Name | N-butyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760630 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-butyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C11H14N2O4S/c1-2-3-6-12-18(15,16)8-4-5-10-9(7-8)13-11(14)17-10/h4-5,7,12H,2-3,6H2,1H3,(H,13,14) |
| InChIKey | KBTGAECIDYRYQX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|