C11H14N2O6S — CID 146024908
N-[2-(2-hydroxyethoxy)ethyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide (PubChem CID 146024908) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 146024908 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
| SMILES | O=c1[nH]c2cc(S(=O)(=O)NCCOCCO)ccc2o1 |
| InChI | InChI=1S/C11H14N2O6S/c14-4-6-18-5-3-12-20(16,17)8-1-2-10-9(7-8)13-11(15)19-10/h1-2,7,12,14H,3-6H2,(H,13,15) |
| InChIKey | BMTOGIQDDRWJMO-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|