C13H16N2O6S — CID 7573837
6-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]hexanoic acid (PubChem CID 7573837) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is 6-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]hexanoic acid.
| Compound Name | 6-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 7573837 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 6-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNS(=O)(=O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C13H16N2O6S/c16-12(17)4-2-1-3-7-14-22(19,20)9-5-6-10-11(8-9)21-13(18)15-10/h5-6,8,14H,1-4,7H2,(H,15,18)(H,16,17) |
| InChIKey | LZGYFQCYPWTEIX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|