C13H13N3O4S — CID 110789459
2-oxo-N-[2-(1H-pyrrol-3-yl)ethyl]-3H-1,3-benzoxazole-6-sulfonamide (PubChem CID 110789459) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-oxo-N-[2-(1H-pyrrol-3-yl)ethyl]-3H-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 2-oxo-N-[2-(1H-pyrrol-3-yl)ethyl]-3H-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 110789459 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-oxo-N-[2-(1H-pyrrol-3-yl)ethyl]-3H-1,3-benzoxazole-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)NCCc3cc[nH]c3)cc2o1 |
| InChI | InChI=1S/C13H13N3O4S/c17-13-16-11-2-1-10(7-12(11)20-13)21(18,19)15-6-4-9-3-5-14-8-9/h1-3,5,7-8,14-15H,4,6H2,(H,16,17) |
| InChIKey | ZOJCKGQCFQXKQL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |