C10H16N2O6S2 — CID 62497976
3-N-[2-(2-hydroxyethoxy)ethyl]benzene-1,3-disulfonamide (PubChem CID 62497976) has the molecular formula C10H16N2O6S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-N-[2-(2-hydroxyethoxy)ethyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[2-(2-hydroxyethoxy)ethyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 62497976 |
| Molecular Formula | C10H16N2O6S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 3-N-[2-(2-hydroxyethoxy)ethyl]benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)NCCOCCO)c1 |
| InChI | InChI=1S/C10H16N2O6S2/c11-19(14,15)9-2-1-3-10(8-9)20(16,17)12-4-6-18-7-5-13/h1-3,8,12-13H,4-7H2,(H2,11,14,15) |
| InChIKey | KYUABAMNXGHOHX-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|