C20H29Br2ClN2O8S2 — CID 160861849
2-(2-aminoethoxy)ethanol;3-bromobenzenesulfonyl chloride;3-bromo-N-[2-(2-hydroxyethoxy)ethyl]benzenesulfonamide (PubChem CID 160861849) has the molecular formula C20H29Br2ClN2O8S2 and a molecular weight of 684.85 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethanol;3-bromobenzenesulfonyl chloride;3-bromo-N-[2-(2-hydroxyethoxy)ethyl]benzenesulfonamide.
| Compound Name | 2-(2-aminoethoxy)ethanol;3-bromobenzenesulfonyl chloride;3-bromo-N-[2-(2-hydroxyethoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 160861849 |
| Molecular Formula | C20H29Br2ClN2O8S2 |
| Molecular Weight | 684.85 g/mol |
| Exact Mass | 681.94 |
| IUPAC Name | 2-(2-aminoethoxy)ethanol;3-bromobenzenesulfonyl chloride;3-bromo-N-[2-(2-hydroxyethoxy)ethyl]benzenesulfonamide |
| SMILES | NCCOCCO.O=S(=O)(Cl)c1cccc(Br)c1.O=S(=O)(NCCOCCO)c1cccc(Br)c1 |
| InChI | InChI=1S/C10H14BrNO4S.C6H4BrClO2S.C4H11NO2/c11-9-2-1-3-10(8-9)17(14,15)12-4-6-16-7-5-13;7-5-2-1-3-6(4-5)11(8,9)10;5-1-3-7-4-2-6/h1-3,8,12-13H,4-7H2;1-4H;6H,1-5H2 |
| InChIKey | SKPBTEJLPKFLTG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.85 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|