C13H8F2N2O4S — CID 110760759
N-(2,6-difluorophenyl)-2-oxo-3H-1,3-benzoxazole-5-sulfonamide (PubChem CID 110760759) has the molecular formula C13H8F2N2O4S and a molecular weight of 326.28 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-oxo-3H-1,3-benzoxazole-5-sulfonamide.
| Compound Name | N-(2,6-difluorophenyl)-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760759 |
| Molecular Formula | C13H8F2N2O4S |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
| SMILES | O=c1[nH]c2cc(S(=O)(=O)Nc3c(F)cccc3F)ccc2o1 |
| InChI | InChI=1S/C13H8F2N2O4S/c14-8-2-1-3-9(15)12(8)17-22(19,20)7-4-5-11-10(6-7)16-13(18)21-11/h1-6,17H,(H,16,18) |
| InChIKey | VZOIMOOATNWLRR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |