C12H16N2O4S — CID 110760690
N-butyl-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide (PubChem CID 110760690) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-butyl-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide.
| Compound Name | N-butyl-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760690 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-butyl-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H16N2O4S/c1-3-4-7-14(2)19(16,17)9-5-6-11-10(8-9)13-12(15)18-11/h5-6,8H,3-4,7H2,1-2H3,(H,13,15) |
| InChIKey | WAJUPRXVXRBFJN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |