C15H14N2O4S — CID 110760655
N-benzyl-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide (PubChem CID 110760655) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide.
| Compound Name | N-benzyl-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760655 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-benzyl-N-methyl-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H14N2O4S/c1-17(10-11-5-3-2-4-6-11)22(19,20)12-7-8-14-13(9-12)16-15(18)21-14/h2-9H,10H2,1H3,(H,16,18) |
| InChIKey | JJOYRWBWJUYDFT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |