C18H15N2O5S- — CID 4050234
6-[benzyl(methyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 4050234) has the molecular formula C18H15N2O5S- and a molecular weight of 371.39 g/mol. Its IUPAC name is 6-[benzyl(methyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | 6-[benzyl(methyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 4050234 |
| Molecular Formula | C18H15N2O5S- |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 6-[benzyl(methyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc2[nH]cc(C(=O)[O-])c(=O)c2c1 |
| InChI | InChI=1S/C18H16N2O5S/c1-20(11-12-5-3-2-4-6-12)26(24,25)13-7-8-16-14(9-13)17(21)15(10-19-16)18(22)23/h2-10H,11H2,1H3,(H,19,21)(H,22,23)/p-1 |
| InChIKey | SCOPQECCRFYYCR-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |