C22H25N3O5S — CID 141331217
6-(diethylsulfamoyl)-N-[(3-methoxyphenyl)methyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 141331217) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 6-(diethylsulfamoyl)-N-[(3-methoxyphenyl)methyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 6-(diethylsulfamoyl)-N-[(3-methoxyphenyl)methyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 141331217 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 6-(diethylsulfamoyl)-N-[(3-methoxyphenyl)methyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2[nH]cc(C(=O)NCc3cccc(OC)c3)c(=O)c2c1 |
| InChI | InChI=1S/C22H25N3O5S/c1-4-25(5-2)31(28,29)17-9-10-20-18(12-17)21(26)19(14-23-20)22(27)24-13-15-7-6-8-16(11-15)30-3/h6-12,14H,4-5,13H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | GWKNVKLZEKCOFR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |