C22H26N4O4S — CID 53136005
1-[4-(diethylsulfamoyl)phenyl]-N-[(3-methoxyphenyl)methyl]imidazole-4-carboxamide (PubChem CID 53136005) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-[4-(diethylsulfamoyl)phenyl]-N-[(3-methoxyphenyl)methyl]imidazole-4-carboxamide.
| Compound Name | 1-[4-(diethylsulfamoyl)phenyl]-N-[(3-methoxyphenyl)methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 53136005 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1-[4-(diethylsulfamoyl)phenyl]-N-[(3-methoxyphenyl)methyl]imidazole-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-n2cnc(C(=O)NCc3cccc(OC)c3)c2)cc1 |
| InChI | InChI=1S/C22H26N4O4S/c1-4-26(5-2)31(28,29)20-11-9-18(10-12-20)25-15-21(24-16-25)22(27)23-14-17-7-6-8-19(13-17)30-3/h6-13,15-16H,4-5,14H2,1-3H3,(H,23,27) |
| InChIKey | DZCGLFCWUKKNJG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |