C22H25N3O5S — CID 3371833
6-[(3,4-dimethylphenyl)-methylsulfamoyl]-N-(2-methoxyethyl)-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 3371833) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 6-[(3,4-dimethylphenyl)-methylsulfamoyl]-N-(2-methoxyethyl)-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 6-[(3,4-dimethylphenyl)-methylsulfamoyl]-N-(2-methoxyethyl)-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 3371833 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 6-[(3,4-dimethylphenyl)-methylsulfamoyl]-N-(2-methoxyethyl)-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | COCCNC(=O)c1c[nH]c2ccc(S(=O)(=O)N(C)c3ccc(C)c(C)c3)cc2c1=O |
| InChI | InChI=1S/C22H25N3O5S/c1-14-5-6-16(11-15(14)2)25(3)31(28,29)17-7-8-20-18(12-17)21(26)19(13-24-20)22(27)23-9-10-30-4/h5-8,11-13H,9-10H2,1-4H3,(H,23,27)(H,24,26) |
| InChIKey | VWFVOTGWGHPOSO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|