C21H22ClN3O4S — CID 4615282
N-tert-butyl-6-[(4-chlorophenyl)-methylsulfamoyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 4615282) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is N-tert-butyl-6-[(4-chlorophenyl)-methylsulfamoyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-tert-butyl-6-[(4-chlorophenyl)-methylsulfamoyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 4615282 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-tert-butyl-6-[(4-chlorophenyl)-methylsulfamoyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc2[nH]cc(C(=O)NC(C)(C)C)c(=O)c2c1 |
| InChI | InChI=1S/C21H22ClN3O4S/c1-21(2,3)24-20(27)17-12-23-18-10-9-15(11-16(18)19(17)26)30(28,29)25(4)14-7-5-13(22)6-8-14/h5-12H,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | ONWXZBKFJIOTFN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |