C14H15ClN2O4 — CID 118460150
N-tert-butyl-8-chloro-6,7-dihydroxy-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 118460150) has the molecular formula C14H15ClN2O4 and a molecular weight of 310.74 g/mol. Its IUPAC name is N-tert-butyl-8-chloro-6,7-dihydroxy-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-tert-butyl-8-chloro-6,7-dihydroxy-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 118460150 |
| Molecular Formula | C14H15ClN2O4 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-tert-butyl-8-chloro-6,7-dihydroxy-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1c[nH]c2c(Cl)c(O)c(O)cc2c1=O |
| InChI | InChI=1S/C14H15ClN2O4/c1-14(2,3)17-13(21)7-5-16-10-6(11(7)19)4-8(18)12(20)9(10)15/h4-5,18,20H,1-3H3,(H,16,19)(H,17,21) |
| InChIKey | PIQUKQMETSTVAB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|