C13H13ClN2O4 — CID 131977166
5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide (PubChem CID 131977166) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide.
| Compound Name | 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 131977166 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide |
| SMILES | CC(C)NC(=O)c1c[nH]c2cc(O)c(O)c(Cl)c2c1=O |
| InChI | InChI=1S/C13H13ClN2O4/c1-5(2)16-13(20)6-4-15-7-3-8(17)12(19)10(14)9(7)11(6)18/h3-5,17,19H,1-2H3,(H,15,18)(H,16,20) |
| InChIKey | IBKNHJNLCFYCAZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|