About 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide
5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide (PubChem CID 131977166) has the molecular formula C13H13ClN2O4
and a molecular weight of 296.71 g/mol. Its IUPAC name is 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide |
| PubChem CID | 131977166 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide |
| SMILES | CC(C)NC(=O)c1c[nH]c2cc(O)c(O)c(Cl)c2c1=O |
| InChI | InChI=1S/C13H13ClN2O4/c1-5(2)16-13(20)6-4-15-7-3-8(17)12(19)10(14)9(7)11(6)18/h3-5,17,19H,1-2H3,(H,15,18)(H,16,20) |
| InChIKey | IBKNHJNLCFYCAZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide?
The IUPAC name of 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide (CID 131977166) is 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide.
What is the SMILES notation for 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide?
The canonical SMILES for 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide is CC(C)NC(=O)c1c[nH]c2cc(O)c(O)c(Cl)c2c1=O.
What is the InChIKey of 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide?
The InChIKey is IBKNHJNLCFYCAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN2O4/c1-5(2)16-13(20)6-4-15-7-3-8(17)12(19)10(14)9(7)11(6)18/h3-5,17,19H,1-2H3,(H,15,18)(H,16,20).
What are the key properties of 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide?
5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide has a molecular weight of 296.71 g/mol, XLogP of 1.73, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6,7-dihydroxy-4-oxo-N-propan-2-yl-1H-quinoline-3-carboxamide is sourced from PubChem (CID 131977166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).