C9H11FN2O3 — CID 118460094
3-fluoro-5-hydroxy-4-oxo-N-propan-2-yl-1H-pyridine-2-carboxamide (PubChem CID 118460094) has the molecular formula C9H11FN2O3 and a molecular weight of 214.20 g/mol. Its IUPAC name is 3-fluoro-5-hydroxy-4-oxo-N-propan-2-yl-1H-pyridine-2-carboxamide.
| Compound Name | 3-fluoro-5-hydroxy-4-oxo-N-propan-2-yl-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118460094 |
| Molecular Formula | C9H11FN2O3 |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-fluoro-5-hydroxy-4-oxo-N-propan-2-yl-1H-pyridine-2-carboxamide |
| SMILES | CC(C)NC(=O)c1[nH]cc(O)c(=O)c1F |
| InChI | InChI=1S/C9H11FN2O3/c1-4(2)12-9(15)7-6(10)8(14)5(13)3-11-7/h3-4,13H,1-2H3,(H,11,14)(H,12,15) |
| InChIKey | CJKDKHYXAUCBDA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |