C12H16FNO — CID 130223984
2-fluoro-3,4-dimethyl-N-propan-2-ylbenzamide (PubChem CID 130223984) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 2-fluoro-3,4-dimethyl-N-propan-2-ylbenzamide.
| Compound Name | 2-fluoro-3,4-dimethyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 130223984 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-fluoro-3,4-dimethyl-N-propan-2-ylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(C)C)c(F)c1C |
| InChI | InChI=1S/C12H16FNO/c1-7(2)14-12(15)10-6-5-8(3)9(4)11(10)13/h5-7H,1-4H3,(H,14,15) |
| InChIKey | WKLUYUSMQKSLOB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |