C8H7BrFNO2 — CID 131110604
4-bromo-2-fluoro-N-hydroxy-3-methylbenzamide (PubChem CID 131110604) has the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-hydroxy-3-methylbenzamide.
| Compound Name | 4-bromo-2-fluoro-N-hydroxy-3-methylbenzamide |
|---|---|
| PubChem CID | 131110604 |
| Molecular Formula | C8H7BrFNO2 |
| Molecular Weight | 248.05 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 4-bromo-2-fluoro-N-hydroxy-3-methylbenzamide |
| SMILES | Cc1c(Br)ccc(C(=O)NO)c1F |
| InChI | InChI=1S/C8H7BrFNO2/c1-4-6(9)3-2-5(7(4)10)8(12)11-13/h2-3,13H,1H3,(H,11,12) |
| InChIKey | BXDIBTCFGUUMLT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.05 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|