C15H20FNO — CID 80711780
N-(1-cyclopentylethyl)-2-fluoro-3-methylbenzamide (PubChem CID 80711780) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is N-(1-cyclopentylethyl)-2-fluoro-3-methylbenzamide.
| Compound Name | N-(1-cyclopentylethyl)-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 80711780 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-(1-cyclopentylethyl)-2-fluoro-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(C)C2CCCC2)c1F |
| InChI | InChI=1S/C15H20FNO/c1-10-6-5-9-13(14(10)16)15(18)17-11(2)12-7-3-4-8-12/h5-6,9,11-12H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | KBULZQZPJKRAOX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |