C16H21F2NO2 — CID 138045628
N-[1-(4,4-difluorocyclohexyl)ethyl]-2-hydroxy-3-methylbenzamide (PubChem CID 138045628) has the molecular formula C16H21F2NO2 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-[1-(4,4-difluorocyclohexyl)ethyl]-2-hydroxy-3-methylbenzamide.
| Compound Name | N-[1-(4,4-difluorocyclohexyl)ethyl]-2-hydroxy-3-methylbenzamide |
|---|---|
| PubChem CID | 138045628 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[1-(4,4-difluorocyclohexyl)ethyl]-2-hydroxy-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(C)C2CCC(F)(F)CC2)c1O |
| InChI | InChI=1S/C16H21F2NO2/c1-10-4-3-5-13(14(10)20)15(21)19-11(2)12-6-8-16(17,18)9-7-12/h3-5,11-12,20H,6-9H2,1-2H3,(H,19,21) |
| InChIKey | MYNSTIDXIBBGRZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |