C14H17NO4 — CID 113354364
3-cyclopropyl-2-[(2-hydroxy-3-methylbenzoyl)amino]propanoic acid (PubChem CID 113354364) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-cyclopropyl-2-[(2-hydroxy-3-methylbenzoyl)amino]propanoic acid.
| Compound Name | 3-cyclopropyl-2-[(2-hydroxy-3-methylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 113354364 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-cyclopropyl-2-[(2-hydroxy-3-methylbenzoyl)amino]propanoic acid |
| SMILES | Cc1cccc(C(=O)NC(CC2CC2)C(=O)O)c1O |
| InChI | InChI=1S/C14H17NO4/c1-8-3-2-4-10(12(8)16)13(17)15-11(14(18)19)7-9-5-6-9/h2-4,9,11,16H,5-7H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | ZNUOTWSCPLABGL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |