C11H9ClN2O4 — CID 118461158
5-chloro-6,7-dihydroxy-N-methyl-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 118461158) has the molecular formula C11H9ClN2O4 and a molecular weight of 268.66 g/mol. Its IUPAC name is 5-chloro-6,7-dihydroxy-N-methyl-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 5-chloro-6,7-dihydroxy-N-methyl-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 118461158 |
| Molecular Formula | C11H9ClN2O4 |
| Molecular Weight | 268.66 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-chloro-6,7-dihydroxy-N-methyl-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CNC(=O)c1c[nH]c2cc(O)c(O)c(Cl)c2c1=O |
| InChI | InChI=1S/C11H9ClN2O4/c1-13-11(18)4-3-14-5-2-6(15)10(17)8(12)7(5)9(4)16/h2-3,15,17H,1H3,(H,13,18)(H,14,16) |
| InChIKey | PWGHDJAGWHAJLA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.66 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|