methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate

C11H7F2NO3 — CID 102614566

IUPACmethyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate
SMILESCOC(=O)c1c[nH]c2cc(F)cc(F)c2c1=O
InChIInChI=1S/C11H7F2NO3/c1-17-11(16)6-4-14-8-3-5(12)2-7(13)9(8)10(6)15/h2-4H,1H3,(H,14,15)
InChIKeyXNYPGZYTPRGCPQ-UHFFFAOYSA-N
MW239.18 g/mol
LogP1.59
Rot. Bonds1

About methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate

methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 102614566) has the molecular formula C11H7F2NO3 and a molecular weight of 239.18 g/mol. Its IUPAC name is methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate.

Molecular Properties

Compound Namemethyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate
PubChem CID102614566
Molecular FormulaC11H7F2NO3
Molecular Weight239.18 g/mol
Exact Mass239.04
IUPAC Namemethyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate
SMILESCOC(=O)c1c[nH]c2cc(F)cc(F)c2c1=O
InChIInChI=1S/C11H7F2NO3/c1-17-11(16)6-4-14-8-3-5(12)2-7(13)9(8)10(6)15/h2-4H,1H3,(H,14,15)
InChIKeyXNYPGZYTPRGCPQ-UHFFFAOYSA-N
XLogP1.59
TPSA59.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.18
LogP ≤ 51.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate?
The IUPAC name of methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate (CID 102614566) is methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate.
What is the SMILES notation for methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate?
The canonical SMILES for methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate is COC(=O)c1c[nH]c2cc(F)cc(F)c2c1=O.
What is the InChIKey of methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate?
The InChIKey is XNYPGZYTPRGCPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2NO3/c1-17-11(16)6-4-14-8-3-5(12)2-7(13)9(8)10(6)15/h2-4H,1H3,(H,14,15).
What are the key properties of methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate?
methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate has a molecular weight of 239.18 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,7-difluoro-4-oxo-1H-quinoline-3-carboxylate is sourced from PubChem (CID 102614566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).