C11H6ClF2NO2 — CID 102614340
methyl 4-chloro-5,7-difluoroquinoline-3-carboxylate (PubChem CID 102614340) has the molecular formula C11H6ClF2NO2 and a molecular weight of 257.62 g/mol. Its IUPAC name is methyl 4-chloro-5,7-difluoroquinoline-3-carboxylate.
| Compound Name | methyl 4-chloro-5,7-difluoroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 102614340 |
| Molecular Formula | C11H6ClF2NO2 |
| Molecular Weight | 257.62 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | methyl 4-chloro-5,7-difluoroquinoline-3-carboxylate |
| SMILES | COC(=O)c1cnc2cc(F)cc(F)c2c1Cl |
| InChI | InChI=1S/C11H6ClF2NO2/c1-17-11(16)6-4-15-8-3-5(13)2-7(14)9(8)10(6)12/h2-4H,1H3 |
| InChIKey | SZMQKIYTLYSYRG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |