C11H5F3N4O2 — CID 102614678
methyl 4-azido-5,6,7-trifluoroquinoline-3-carboxylate (PubChem CID 102614678) has the molecular formula C11H5F3N4O2 and a molecular weight of 282.18 g/mol. Its IUPAC name is methyl 4-azido-5,6,7-trifluoroquinoline-3-carboxylate.
| Compound Name | methyl 4-azido-5,6,7-trifluoroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 102614678 |
| Molecular Formula | C11H5F3N4O2 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | methyl 4-azido-5,6,7-trifluoroquinoline-3-carboxylate |
| SMILES | COC(=O)c1cnc2cc(F)c(F)c(F)c2c1N=[N+]=[N-] |
| InChI | InChI=1S/C11H5F3N4O2/c1-20-11(19)4-3-16-6-2-5(12)8(13)9(14)7(6)10(4)17-18-15/h2-3H,1H3 |
| InChIKey | HRUUSFPQSZGAGR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|