C13H11BrN4O2 — CID 107577355
methyl 4-azido-6-bromo-5,7-dimethylquinoline-3-carboxylate (PubChem CID 107577355) has the molecular formula C13H11BrN4O2 and a molecular weight of 335.16 g/mol. Its IUPAC name is methyl 4-azido-6-bromo-5,7-dimethylquinoline-3-carboxylate.
| Compound Name | methyl 4-azido-6-bromo-5,7-dimethylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 107577355 |
| Molecular Formula | C13H11BrN4O2 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | methyl 4-azido-6-bromo-5,7-dimethylquinoline-3-carboxylate |
| SMILES | COC(=O)c1cnc2cc(C)c(Br)c(C)c2c1N=[N+]=[N-] |
| InChI | InChI=1S/C13H11BrN4O2/c1-6-4-9-10(7(2)11(6)14)12(17-18-15)8(5-16-9)13(19)20-3/h4-5H,1-3H3 |
| InChIKey | GELHXPVVFARLEJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|