C10H6BrN5O2 — CID 102941646
methyl 4-azido-7-bromo-1,8-naphthyridine-3-carboxylate (PubChem CID 102941646) has the molecular formula C10H6BrN5O2 and a molecular weight of 308.10 g/mol. Its IUPAC name is methyl 4-azido-7-bromo-1,8-naphthyridine-3-carboxylate.
| Compound Name | methyl 4-azido-7-bromo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 102941646 |
| Molecular Formula | C10H6BrN5O2 |
| Molecular Weight | 308.10 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | methyl 4-azido-7-bromo-1,8-naphthyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc2nc(Br)ccc2c1N=[N+]=[N-] |
| InChI | InChI=1S/C10H6BrN5O2/c1-18-10(17)6-4-13-9-5(8(6)15-16-12)2-3-7(11)14-9/h2-4H,1H3 |
| InChIKey | XBLDOHDTXSVMQH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 100.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.10 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|